What is the 4-N-HEPTYLOXYBENZALDEHYDE?

4-N-HEPTYLOXYBENZALDEHYDE is , while it's Molecular Formula is C14H20 O2. Used in Fragrance and Flavoring Industry: 4-N-Heptyloxybenzaldehyde is used as a key ingredient in the creation of fragrances and flavoring agents due to its distinctive aromatic properties. It contributes to the development of complex scents and tastes in a variety of consumer products, enhancing their appeal and marketability. Used in Pharmaceutical Industry: In the pharmaceutical sector, 4-N-Heptyloxybenzaldehyde serves as an intermediate in the synthesis of various medicinal compounds. Its unique chemical structure allows it to be a building block for the development of new drugs, potentially leading to advancements in healthcare and treatment options. Used in Agrochemical Industry: 4-N-Heptyloxybenzaldehyde is also utilized in the agrochemical industry, where it plays a role in the production of pesticides, herbicides, and other agricultural chemicals. Its involvement in these processes helps to improve crop yields and protect plants from pests and diseases, contributing to global food security and agricultural sustainability.

What is the CAS number for 4-N-HEPTYLOXYBENZALDEHYDE?

The CAS number of 4-N-HEPTYLOXYBENZALDEHYDE is 27893-41-0.

What is 4-N-HEPTYLOXYBENZALDEHYDE (27893-41-0) used for?

4-N-Heptyloxybenzaldehyde, with the molecular formula C14H20O2, is an organic compound known for its aromatic benzene ring, a heptyloxy group, and an aldehyde functional group. The heptyloxy group features a seven-carbon chain attached to the benzene ring, while the aldehyde group consists of a carbon double-bonded to oxygen and single-bonded to hydrogen. 4-N-HEPTYLOXYBENZALDEHYDE is widely recognized for its role in the synthesis of other organic compounds and as an intermediate in the production of various chemicals.InChI:InChI=1/C14H20O2/c1-2-3-4-5-6-11-16-14-9-7-13(12-15)8-10-14/h7-10,12H,2-6,11H2,1H3

What is the 4-N-HEPTYLOXYBENZALDEHYDE?

4-N-HEPTYLOXYBENZALDEHYDE is , while it's Molecular Formula is C14H20 O2. Used in Fragrance and Flavoring Industry: 4-N-Heptyloxybenzaldehyde is used as a key ingredient in the creation of fragrances and flavoring agents due to its distinctive aromatic properties. It contributes to the development of complex scents and tastes in a variety of consumer products, enhancing their appeal and marketability. Used in Pharmaceutical Industry: In the pharmaceutical sector, 4-N-Heptyloxybenzaldehyde serves as an intermediate in the synthesis of various medicinal compounds. Its unique chemical structure allows it to be a building block for the development of new drugs, potentially leading to advancements in healthcare and treatment options. Used in Agrochemical Industry: 4-N-Heptyloxybenzaldehyde is also utilized in the agrochemical industry, where it plays a role in the production of pesticides, herbicides, and other agricultural chemicals. Its involvement in these processes helps to improve crop yields and protect plants from pests and diseases, contributing to global food security and agricultural sustainability.

What is the CAS number for 4-N-HEPTYLOXYBENZALDEHYDE?

The CAS number of 4-N-HEPTYLOXYBENZALDEHYDE is 27893-41-0.

What is 4-N-HEPTYLOXYBENZALDEHYDE (27893-41-0) used for?

4-N-Heptyloxybenzaldehyde, with the molecular formula C14H20O2, is an organic compound known for its aromatic benzene ring, a heptyloxy group, and an aldehyde functional group. The heptyloxy group features a seven-carbon chain attached to the benzene ring, while the aldehyde group consists of a carbon double-bonded to oxygen and single-bonded to hydrogen. 4-N-HEPTYLOXYBENZALDEHYDE is widely recognized for its role in the synthesis of other organic compounds and as an intermediate in the production of various chemicals.InChI:InChI=1/C14H20O2/c1-2-3-4-5-6-11-16-14-9-7-13(12-15)8-10-14/h7-10,12H,2-6,11H2,1H3